C25H24N6O2S — CID 90913817
ethyl 2-[(9S)-4,5,13-trimethyl-7-(4-pyrimidin-5-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 90913817) has the molecular formula C25H24N6O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is ethyl 2-[(9S)-4,5,13-trimethyl-7-(4-pyrimidin-5-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | ethyl 2-[(9S)-4,5,13-trimethyl-7-(4-pyrimidin-5-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 90913817 |
| Molecular Formula | C25H24N6O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | ethyl 2-[(9S)-4,5,13-trimethyl-7-(4-pyrimidin-5-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1N=C(c2ccc(-c3cncnc3)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C25H24N6O2S/c1-5-33-21(32)10-20-24-30-29-16(4)31(24)25-22(14(2)15(3)34-25)23(28-20)18-8-6-17(7-9-18)19-11-26-13-27-12-19/h6-9,11-13,20H,5,10H2,1-4H3/t20-/m0/s1 |
| InChIKey | OIULBYURVVMTHW-FQEVSTJZSA-N |
| XLogP | 4.56 |
| TPSA | 95.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |