C29H31N5O2S — CID 177092983
tert-butyl 2-[7-[4-(4-aminophenyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 177092983) has the molecular formula C29H31N5O2S and a molecular weight of 513.67 g/mol. Its IUPAC name is tert-butyl 2-[7-[4-(4-aminophenyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | tert-butyl 2-[7-[4-(4-aminophenyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 177092983 |
| Molecular Formula | C29H31N5O2S |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | tert-butyl 2-[7-[4-(4-aminophenyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(-c3ccc(N)cc3)cc1)=NC(CC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C29H31N5O2S/c1-16-17(2)37-28-25(16)26(21-9-7-19(8-10-21)20-11-13-22(30)14-12-20)31-23(15-24(35)36-29(4,5)6)27-33-32-18(3)34(27)28/h7-14,23H,15,30H2,1-6H3 |
| InChIKey | RYUPVAVVTGDLJD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|