C28H33N5O2S — CID 146479250
tert-butyl 2-[(9R)-7-[4-(3-amino-3-methylbut-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 146479250) has the molecular formula C28H33N5O2S and a molecular weight of 503.67 g/mol. Its IUPAC name is tert-butyl 2-[(9R)-7-[4-(3-amino-3-methylbut-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | tert-butyl 2-[(9R)-7-[4-(3-amino-3-methylbut-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 146479250 |
| Molecular Formula | C28H33N5O2S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | tert-butyl 2-[(9R)-7-[4-(3-amino-3-methylbut-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C#CC(C)(C)N)cc1)=N[C@H](CC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C28H33N5O2S/c1-16-17(2)36-26-23(16)24(20-11-9-19(10-12-20)13-14-28(7,8)29)30-21(15-22(34)35-27(4,5)6)25-32-31-18(3)33(25)26/h9-12,21H,15,29H2,1-8H3/t21-/m1/s1 |
| InChIKey | UQBSAOUSYAQZNQ-OAQYLSRUSA-N |
| XLogP | 4.97 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|