C27H31N5O2S — CID 146478912
tert-butyl 2-[7-[4-(4-aminobut-3-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 146478912) has the molecular formula C27H31N5O2S and a molecular weight of 489.65 g/mol. Its IUPAC name is tert-butyl 2-[7-[4-(4-aminobut-3-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | tert-butyl 2-[7-[4-(4-aminobut-3-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 146478912 |
| Molecular Formula | C27H31N5O2S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | tert-butyl 2-[7-[4-(4-aminobut-3-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(CCC#CN)cc1)=NC(CC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C27H31N5O2S/c1-16-17(2)35-26-23(16)24(20-12-10-19(11-13-20)9-7-8-14-28)29-21(15-22(33)34-27(4,5)6)25-31-30-18(3)32(25)26/h10-13,21H,7,9,15,28H2,1-6H3 |
| InChIKey | KGDQRHMZNHPOHJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|