C27H33N5O3S — CID 146479253
tert-butyl 2-[(9S)-7-[4-[(Z)-4-(hydroxyamino)but-3-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 146479253) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is tert-butyl 2-[(9S)-7-[4-[(Z)-4-(hydroxyamino)but-3-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | tert-butyl 2-[(9S)-7-[4-[(Z)-4-(hydroxyamino)but-3-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 146479253 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | tert-butyl 2-[(9S)-7-[4-[(Z)-4-(hydroxyamino)but-3-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(CC/C=C\NO)cc1)=N[C@@H](CC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C27H33N5O3S/c1-16-17(2)36-26-23(16)24(20-12-10-19(11-13-20)9-7-8-14-28-34)29-21(15-22(33)35-27(4,5)6)25-31-30-18(3)32(25)26/h8,10-14,21,28,34H,7,9,15H2,1-6H3/b14-8-/t21-/m0/s1 |
| InChIKey | TWLWITVBFMLNQI-IWRDUPADSA-N |
| XLogP | 5.30 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|