C28H35N5O2S — CID 146479179
tert-butyl 2-[(9S)-7-[4-[(E)-4-amino-2-methylbut-2-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 146479179) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is tert-butyl 2-[(9S)-7-[4-[(E)-4-amino-2-methylbut-2-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | tert-butyl 2-[(9S)-7-[4-[(E)-4-amino-2-methylbut-2-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 146479179 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | tert-butyl 2-[(9S)-7-[4-[(E)-4-amino-2-methylbut-2-enyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | C/C(=C\CN)Cc1ccc(C2=N[C@@H](CC(=O)OC(C)(C)C)c3nnc(C)n3-c3sc(C)c(C)c32)cc1 |
| InChI | InChI=1S/C28H35N5O2S/c1-16(12-13-29)14-20-8-10-21(11-9-20)25-24-17(2)18(3)36-27(24)33-19(4)31-32-26(33)22(30-25)15-23(34)35-28(5,6)7/h8-12,22H,13-15,29H2,1-7H3/b16-12+/t22-/m0/s1 |
| InChIKey | UASNRMKDCOHADD-KFGZODLXSA-N |
| XLogP | 5.33 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|