C26H20O7 — CID 163722978
(3,4-dibenzoyloxy-2,3-dihydrofuran-5-yl)methyl benzoate (PubChem CID 163722978) has the molecular formula C26H20O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is (3,4-dibenzoyloxy-2,3-dihydrofuran-5-yl)methyl benzoate.
| Compound Name | (3,4-dibenzoyloxy-2,3-dihydrofuran-5-yl)methyl benzoate |
|---|---|
| PubChem CID | 163722978 |
| Molecular Formula | C26H20O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (3,4-dibenzoyloxy-2,3-dihydrofuran-5-yl)methyl benzoate |
| SMILES | O=C(OCC1=C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)CO1)c1ccccc1 |
| InChI | InChI=1S/C26H20O7/c27-24(18-10-4-1-5-11-18)31-16-21-23(33-26(29)20-14-8-3-9-15-20)22(17-30-21)32-25(28)19-12-6-2-7-13-19/h1-15,22H,16-17H2 |
| InChIKey | KTEDCMJUGWQFRH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|