C34H35FN4O3 — CID 163724605
CID 163724605 (PubChem CID 163724605) has the molecular formula C34H35FN4O3 and a molecular weight of 566.68 g/mol.
| Compound Name | CID 163724605 |
|---|---|
| PubChem CID | 163724605 |
| Molecular Formula | C34H35FN4O3 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | — |
| SMILES | COc1cc(C#N)ccc1NC(=O)[C@@H]1NC2(C[C@@H]2C(C)(C)C)[C@@]2(C(=O)Nc3cc(C)ccc32)C1c1cc(C)cc(F)c1 |
| InChI | InChI=1S/C34H35FN4O3/c1-18-7-9-23-25(13-18)38-31(41)34(23)28(21-11-19(2)12-22(35)15-21)29(39-33(34)16-27(33)32(3,4)5)30(40)37-24-10-8-20(17-36)14-26(24)42-6/h7-15,27-29,39H,16H2,1-6H3,(H,37,40)(H,38,41)/t27-,28?,29-,33?,34-/m1/s1 |
| InChIKey | KUMZPCJIGOAZKL-CCXVVZNFSA-N |
| XLogP | 5.71 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |