C31H29Cl2FN4O4 — CID 118113711
[(2'R,3R,3'R,5'S)-6-chloro-3'-(3-chloro-5-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyano-2-methoxyphenyl)carbamate (PubChem CID 118113711) has the molecular formula C31H29Cl2FN4O4 and a molecular weight of 611.50 g/mol. Its IUPAC name is [(2'R,3R,3'R,5'S)-6-chloro-3'-(3-chloro-5-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyano-2-methoxyphenyl)carbamate.
| Compound Name | [(2'R,3R,3'R,5'S)-6-chloro-3'-(3-chloro-5-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyano-2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 118113711 |
| Molecular Formula | C31H29Cl2FN4O4 |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | [(2'R,3R,3'R,5'S)-6-chloro-3'-(3-chloro-5-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyano-2-methoxyphenyl)carbamate |
| SMILES | COc1cc(C#N)ccc1NC(=O)O[C@H]1N[C@@H](CC(C)(C)C)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C31H29Cl2FN4O4/c1-30(2,3)14-25-31(21-7-6-18(32)13-23(21)36-28(31)39)26(17-10-19(33)12-20(34)11-17)27(38-25)42-29(40)37-22-8-5-16(15-35)9-24(22)41-4/h5-13,25-27,38H,14H2,1-4H3,(H,36,39)(H,37,40)/t25-,26-,27+,31+/m0/s1 |
| InChIKey | NOVPJWAUBRDCFO-VFJZKXQJSA-N |
| XLogP | 6.97 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |