C36H40ClF2N3O3 — CID 165057974
(2R,3S,5S)-3-(3-chloro-2-fluorophenyl)-4-cyano-N-[4-(2,2-dimethylpropanoyl)-2-methoxyphenyl]-5-(2,2-dimethylpropyl)-4-(2-fluoro-4-methylphenyl)pyrrolidine-2-carboxamide (PubChem CID 165057974) has the molecular formula C36H40ClF2N3O3 and a molecular weight of 636.18 g/mol. Its IUPAC name is (2R,3S,5S)-3-(3-chloro-2-fluorophenyl)-4-cyano-N-[4-(2,2-dimethylpropanoyl)-2-methoxyphenyl]-5-(2,2-dimethylpropyl)-4-(2-fluoro-4-methylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,5S)-3-(3-chloro-2-fluorophenyl)-4-cyano-N-[4-(2,2-dimethylpropanoyl)-2-methoxyphenyl]-5-(2,2-dimethylpropyl)-4-(2-fluoro-4-methylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 165057974 |
| Molecular Formula | C36H40ClF2N3O3 |
| Molecular Weight | 636.18 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | (2R,3S,5S)-3-(3-chloro-2-fluorophenyl)-4-cyano-N-[4-(2,2-dimethylpropanoyl)-2-methoxyphenyl]-5-(2,2-dimethylpropyl)-4-(2-fluoro-4-methylphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc(C(=O)C(C)(C)C)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)C(C#N)(c2ccc(C)cc2F)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C36H40ClF2N3O3/c1-20-12-14-23(25(38)16-20)36(19-40)28(18-34(2,3)4)42-31(29(36)22-10-9-11-24(37)30(22)39)33(44)41-26-15-13-21(17-27(26)45-8)32(43)35(5,6)7/h9-17,28-29,31,42H,18H2,1-8H3,(H,41,44)/t28-,29-,31+,36?/m0/s1 |
| InChIKey | OTGVLELFRIEIOG-NUWIKXEISA-N |
| XLogP | 8.12 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.18 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |