C7H9NS — CID 163727993
4-methyliminocyclohexa-1,5-diene-1-thiol (PubChem CID 163727993) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is 4-methyliminocyclohexa-1,5-diene-1-thiol.
| Compound Name | 4-methyliminocyclohexa-1,5-diene-1-thiol |
|---|---|
| PubChem CID | 163727993 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 4-methyliminocyclohexa-1,5-diene-1-thiol |
| SMILES | C/N=C1/C=CC(S)=CC1 |
| InChI | InChI=1S/C7H9NS/c1-8-6-2-4-7(9)5-3-6/h2,4-5,9H,3H2,1H3/b8-6- |
| InChIKey | KXFSXZQZDKJFCY-VURMDHGXSA-N |
| XLogP | 1.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|