C7H11NS — CID 143108378
(3Z)-2-methyliminohexa-3,5-diene-1-thiol (PubChem CID 143108378) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is (3Z)-2-methyliminohexa-3,5-diene-1-thiol.
| Compound Name | (3Z)-2-methyliminohexa-3,5-diene-1-thiol |
|---|---|
| PubChem CID | 143108378 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (3Z)-2-methyliminohexa-3,5-diene-1-thiol |
| SMILES | C=C/C=C\C(CS)=N\C |
| InChI | InChI=1S/C7H11NS/c1-3-4-5-7(6-9)8-2/h3-5,9H,1,6H2,2H3/b5-4-,8-7- |
| InChIKey | FVCKUUHJQKFYPH-UTOQUPLUSA-N |
| XLogP | 1.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|