C30H28O4 — CID 163728001
[4-[4-(3,4-dimethylbenzoyl)oxyphenyl]cyclohexa-1,5-dien-1-yl] 3,4-dimethylbenzoate (PubChem CID 163728001) has the molecular formula C30H28O4 and a molecular weight of 452.55 g/mol. Its IUPAC name is [4-[4-(3,4-dimethylbenzoyl)oxyphenyl]cyclohexa-1,5-dien-1-yl] 3,4-dimethylbenzoate.
| Compound Name | [4-[4-(3,4-dimethylbenzoyl)oxyphenyl]cyclohexa-1,5-dien-1-yl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 163728001 |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [4-[4-(3,4-dimethylbenzoyl)oxyphenyl]cyclohexa-1,5-dien-1-yl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2=CCC(c3ccc(OC(=O)c4ccc(C)c(C)c4)cc3)C=C2)cc1C |
| InChI | InChI=1S/C30H28O4/c1-19-5-7-25(17-21(19)3)29(31)33-27-13-9-23(10-14-27)24-11-15-28(16-12-24)34-30(32)26-8-6-20(2)22(4)18-26/h5-11,13-18,24H,12H2,1-4H3 |
| InChIKey | KXFYELYWCLFIGZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|