C64H50N2O4 — CID 163728722
9-[4-[4-[3-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]carbazol-9-yl]phenyl]phenyl]-8a-methyl-4bH-carbazole-3-carboxylic acid (PubChem CID 163728722) has the molecular formula C64H50N2O4 and a molecular weight of 911.11 g/mol. Its IUPAC name is 9-[4-[4-[3-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]carbazol-9-yl]phenyl]phenyl]-8a-methyl-4bH-carbazole-3-carboxylic acid.
| Compound Name | 9-[4-[4-[3-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]carbazol-9-yl]phenyl]phenyl]-8a-methyl-4bH-carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 163728722 |
| Molecular Formula | C64H50N2O4 |
| Molecular Weight | 911.11 g/mol |
| Exact Mass | 910.38 |
| IUPAC Name | 9-[4-[4-[3-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]carbazol-9-yl]phenyl]phenyl]-8a-methyl-4bH-carbazole-3-carboxylic acid |
| SMILES | COc1cccc(/C=C/c2cc(/C=C/c3cccc(OC)c3)cc(/C=C/c3ccc4c(c3)c3ccccc3n4-c3ccc(-c4ccc(N5c6ccc(C(=O)O)cc6C6C=CC=CC65C)cc4)cc3)c2)c1 |
| InChI | InChI=1S/C64H50N2O4/c1-64-35-7-6-15-59(64)58-42-51(63(67)68)28-34-62(58)66(64)53-31-26-50(27-32-53)49-24-29-52(30-25-49)65-60-16-5-4-14-56(60)57-41-45(23-33-61(57)65)19-22-48-37-46(20-17-43-10-8-12-54(39-43)69-2)36-47(38-48)21-18-44-11-9-13-55(40-44)70-3/h4-42,59H,1-3H3,(H,67,68)/b20-17+,21-18+,22-19+ |
| InChIKey | KXUBQLBOQFBYSN-PNAPYWFZSA-N |
| XLogP | 15.80 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.11 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|