C11H16O2 — CID 163735194
6-ethyl-5-methyl-2,3,5,6-tetrahydro-1,4-benzodioxine (PubChem CID 163735194) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-ethyl-5-methyl-2,3,5,6-tetrahydro-1,4-benzodioxine.
| Compound Name | 6-ethyl-5-methyl-2,3,5,6-tetrahydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 163735194 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6-ethyl-5-methyl-2,3,5,6-tetrahydro-1,4-benzodioxine |
| SMILES | CCC1C=CC2=C(OCCO2)C1C |
| InChI | InChI=1S/C11H16O2/c1-3-9-4-5-10-11(8(9)2)13-7-6-12-10/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | LCZIWPVNWZTYAT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |