C13H17BrF2N2OS — CID 163735803
(S)-N-[1-(6-bromo-2-pyridinyl)-3,3-difluorobutylidene]-2-methylpropane-2-sulfinamide (PubChem CID 163735803) has the molecular formula C13H17BrF2N2OS and a molecular weight of 367.26 g/mol. Its IUPAC name is (S)-N-[1-(6-bromo-2-pyridinyl)-3,3-difluorobutylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[1-(6-bromo-2-pyridinyl)-3,3-difluorobutylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163735803 |
| Molecular Formula | C13H17BrF2N2OS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | (S)-N-[1-(6-bromo-2-pyridinyl)-3,3-difluorobutylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(F)(F)CC(=N[S@@](=O)C(C)(C)C)c1cccc(Br)n1 |
| InChI | InChI=1S/C13H17BrF2N2OS/c1-12(2,3)20(19)18-10(8-13(4,15)16)9-6-5-7-11(14)17-9/h5-7H,8H2,1-4H3/t20-/m0/s1 |
| InChIKey | LDMCNCLLLWREDJ-FQEVSTJZSA-N |
| XLogP | 4.14 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|