C7H11IO5 — CID 163736650
(3S)-2-(hydroxymethyl)-6-iodo-4-methoxy-3,4-dihydro-2H-pyran-3,5-diol (PubChem CID 163736650) has the molecular formula C7H11IO5 and a molecular weight of 302.06 g/mol. Its IUPAC name is (3S)-2-(hydroxymethyl)-6-iodo-4-methoxy-3,4-dihydro-2H-pyran-3,5-diol.
| Compound Name | (3S)-2-(hydroxymethyl)-6-iodo-4-methoxy-3,4-dihydro-2H-pyran-3,5-diol |
|---|---|
| PubChem CID | 163736650 |
| Molecular Formula | C7H11IO5 |
| Molecular Weight | 302.06 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | (3S)-2-(hydroxymethyl)-6-iodo-4-methoxy-3,4-dihydro-2H-pyran-3,5-diol |
| SMILES | COC1C(O)=C(I)OC(CO)[C@@H]1O |
| InChI | InChI=1S/C7H11IO5/c1-12-6-4(10)3(2-9)13-7(8)5(6)11/h3-4,6,9-11H,2H2,1H3/t3?,4-,6?/m0/s1 |
| InChIKey | LEEPCVANTMVJTB-ZSGNRXJESA-N |
| XLogP | -0.08 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.06 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|