C30H24O11 — CID 163740040
[5,7-dihydroxy-8-[(E)-2-phenylethenyl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 163740040) has the molecular formula C30H24O11 and a molecular weight of 560.51 g/mol. Its IUPAC name is [5,7-dihydroxy-8-[(E)-2-phenylethenyl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [5,7-dihydroxy-8-[(E)-2-phenylethenyl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 163740040 |
| Molecular Formula | C30H24O11 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | [5,7-dihydroxy-8-[(E)-2-phenylethenyl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC1Cc2c(O)cc(O)c(/C=C/c3ccccc3)c2OC1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C30H24O11/c31-19-13-20(32)18-12-25(40-30(39)16-10-23(35)27(38)24(36)11-16)28(15-8-21(33)26(37)22(34)9-15)41-29(18)17(19)7-6-14-4-2-1-3-5-14/h1-11,13,25,28,31-38H,12H2/b7-6+ |
| InChIKey | LGYUNODNKAAMIU-VOTSOKGWSA-N |
| XLogP | 4.40 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|