C12H10ClF3N3O3- — CID 163748502
[[(E)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-methoxycarbonylprop-2-enyl]hydrazinylidene]azanide (PubChem CID 163748502) has the molecular formula C12H10ClF3N3O3- and a molecular weight of 336.68 g/mol. Its IUPAC name is [[(E)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-methoxycarbonylprop-2-enyl]hydrazinylidene]azanide.
| Compound Name | [[(E)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-methoxycarbonylprop-2-enyl]hydrazinylidene]azanide |
|---|---|
| PubChem CID | 163748502 |
| Molecular Formula | C12H10ClF3N3O3- |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | [[(E)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-2-methoxycarbonylprop-2-enyl]hydrazinylidene]azanide |
| SMILES | COC(=O)/C(=C/c1ccc(OC(F)(F)F)c(Cl)c1)CNN=[N-] |
| InChI | InChI=1S/C12H10ClF3N3O3/c1-21-11(20)8(6-18-19-17)4-7-2-3-10(9(13)5-7)22-12(14,15)16/h2-5H,6H2,1H3,(H-,17,18)/q-1/b8-4+ |
| InChIKey | FXBYZMNZCXUAGW-XBXARRHUSA-N |
| XLogP | 3.32 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|