About (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate
(3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate (PubChem CID 163749139) has the molecular formula C6H8N2O5
and a molecular weight of 188.14 g/mol. Its IUPAC name is (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate.
Molecular Properties
| Compound Name | (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate |
| PubChem CID | 163749139 |
| Molecular Formula | C6H8N2O5 |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate |
| SMILES | C=NC(=O)OCC(=O)COC(N)=O |
| InChI | InChI=1S/C6H8N2O5/c1-8-6(11)13-3-4(9)2-12-5(7)10/h1-3H2,(H2,7,10) |
| InChIKey | LOMJERRTGZFLJA-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.14 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate?
The IUPAC name of (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate (CID 163749139) is (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate.
What is the SMILES notation for (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate?
The canonical SMILES for (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate is C=NC(=O)OCC(=O)COC(N)=O.
What is the InChIKey of (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate?
The InChIKey is LOMJERRTGZFLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O5/c1-8-6(11)13-3-4(9)2-12-5(7)10/h1-3H2,(H2,7,10).
What are the key properties of (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate?
(3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate has a molecular weight of 188.14 g/mol, XLogP of -0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoyloxy-2-oxopropyl) N-methylidenecarbamate is sourced from PubChem (CID 163749139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).