C20H28N4O — CID 163750506
N-[3-cyano-4-(dimethylaminomethylideneamino)phenyl]-3-(2-methylcyclohexyl)propanamide (PubChem CID 163750506) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[3-cyano-4-(dimethylaminomethylideneamino)phenyl]-3-(2-methylcyclohexyl)propanamide.
| Compound Name | N-[3-cyano-4-(dimethylaminomethylideneamino)phenyl]-3-(2-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 163750506 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-[3-cyano-4-(dimethylaminomethylideneamino)phenyl]-3-(2-methylcyclohexyl)propanamide |
| SMILES | CC1CCCCC1CCC(=O)Nc1ccc(/N=C/N(C)C)c(C#N)c1 |
| InChI | InChI=1S/C20H28N4O/c1-15-6-4-5-7-16(15)8-11-20(25)23-18-9-10-19(17(12-18)13-21)22-14-24(2)3/h9-10,12,14-16H,4-8,11H2,1-3H3,(H,23,25)/b22-14+ |
| InChIKey | LPOWANKYGHEQEB-HYARGMPZSA-N |
| XLogP | 4.32 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|