C16H23N4O5P — CID 175431765
3-[[3-cyano-4-(dimethylaminomethylideneamino)phenyl]carbamoyl]pentan-3-yl dihydrogen phosphate (PubChem CID 175431765) has the molecular formula C16H23N4O5P and a molecular weight of 382.36 g/mol. Its IUPAC name is 3-[[3-cyano-4-(dimethylaminomethylideneamino)phenyl]carbamoyl]pentan-3-yl dihydrogen phosphate.
| Compound Name | 3-[[3-cyano-4-(dimethylaminomethylideneamino)phenyl]carbamoyl]pentan-3-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 175431765 |
| Molecular Formula | C16H23N4O5P |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-[[3-cyano-4-(dimethylaminomethylideneamino)phenyl]carbamoyl]pentan-3-yl dihydrogen phosphate |
| SMILES | CCC(CC)(OP(=O)(O)O)C(=O)Nc1ccc(/N=C/N(C)C)c(C#N)c1 |
| InChI | InChI=1S/C16H23N4O5P/c1-5-16(6-2,25-26(22,23)24)15(21)19-13-7-8-14(12(9-13)10-17)18-11-20(3)4/h7-9,11H,5-6H2,1-4H3,(H,19,21)(H2,22,23,24)/b18-11+ |
| InChIKey | PZMFHGYEMZQFGH-WOJGMQOQSA-N |
| XLogP | 2.39 |
| TPSA | 135.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|