C22H25N5O3 — CID 155660828
tert-butyl 2-[(E)-3-[3-cyano-4-(dimethylaminomethylideneamino)anilino]-3-oxoprop-1-enyl]pyrrole-1-carboxylate (PubChem CID 155660828) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is tert-butyl 2-[(E)-3-[3-cyano-4-(dimethylaminomethylideneamino)anilino]-3-oxoprop-1-enyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-3-[3-cyano-4-(dimethylaminomethylideneamino)anilino]-3-oxoprop-1-enyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 155660828 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl 2-[(E)-3-[3-cyano-4-(dimethylaminomethylideneamino)anilino]-3-oxoprop-1-enyl]pyrrole-1-carboxylate |
| SMILES | CN(C)/C=N/c1ccc(NC(=O)/C=C/c2cccn2C(=O)OC(C)(C)C)cc1C#N |
| InChI | InChI=1S/C22H25N5O3/c1-22(2,3)30-21(29)27-12-6-7-18(27)9-11-20(28)25-17-8-10-19(16(13-17)14-23)24-15-26(4)5/h6-13,15H,1-5H3,(H,25,28)/b11-9+,24-15+ |
| InChIKey | NSLNHYJTHUXNHM-APKAHBCISA-N |
| XLogP | 4.02 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|