C20H28N5O3+ — CID 171095265
tert-butyl 1-[5-cyano-4-(dimethylaminomethylideneamino)-2-methoxyphenyl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate (PubChem CID 171095265) has the molecular formula C20H28N5O3+ and a molecular weight of 386.48 g/mol. Its IUPAC name is tert-butyl 1-[5-cyano-4-(dimethylaminomethylideneamino)-2-methoxyphenyl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate.
| Compound Name | tert-butyl 1-[5-cyano-4-(dimethylaminomethylideneamino)-2-methoxyphenyl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 171095265 |
| Molecular Formula | C20H28N5O3+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl 1-[5-cyano-4-(dimethylaminomethylideneamino)-2-methoxyphenyl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
| SMILES | COc1cc(/N=C/N(C)C)c(C#N)cc1[N+]1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H28N5O3/c1-20(2,3)28-19(26)25-9-7-24(8-10-25)17-11-15(13-21)16(12-18(17)27-6)22-14-23(4)5/h7,11-12,14H,8-10H2,1-6H3/q+1/b22-14+ |
| InChIKey | VVJHOFFGLMJRQH-HYARGMPZSA-N |
| XLogP | 2.75 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|