C19H26N6O3 — CID 171095729
tert-butyl (1R,10R)-7-cyano-6-(dimethylaminomethylideneamino)-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate (PubChem CID 171095729) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is tert-butyl (1R,10R)-7-cyano-6-(dimethylaminomethylideneamino)-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate.
| Compound Name | tert-butyl (1R,10R)-7-cyano-6-(dimethylaminomethylideneamino)-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate |
|---|---|
| PubChem CID | 171095729 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | tert-butyl (1R,10R)-7-cyano-6-(dimethylaminomethylideneamino)-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate |
| SMILES | CN(C)/C=N/c1cnc2c(c1C#N)O[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1N2 |
| InChI | InChI=1S/C19H26N6O3/c1-19(2,3)28-18(26)25-7-6-15-14(10-25)23-17-16(27-15)12(8-20)13(9-21-17)22-11-24(4)5/h9,11,14-15H,6-7,10H2,1-5H3,(H,21,23)/b22-11+/t14-,15-/m1/s1 |
| InChIKey | NIFRXFWYHQBWTP-NSMLUJKXSA-N |
| XLogP | 2.36 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|