C16H21N5O3 — CID 171094664
tert-butyl (1R,10R)-6-amino-7-cyano-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate (PubChem CID 171094664) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is tert-butyl (1R,10R)-6-amino-7-cyano-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate.
| Compound Name | tert-butyl (1R,10R)-6-amino-7-cyano-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate |
|---|---|
| PubChem CID | 171094664 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | tert-butyl (1R,10R)-6-amino-7-cyano-9-oxa-2,4,13-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2Oc3c(ncc(N)c3C#N)N[C@@H]2C1 |
| InChI | InChI=1S/C16H21N5O3/c1-16(2,3)24-15(22)21-5-4-12-11(8-21)20-14-13(23-12)9(6-17)10(18)7-19-14/h7,11-12H,4-5,8,18H2,1-3H3,(H,19,20)/t11-,12-/m1/s1 |
| InChIKey | RKCBESXXAXSBKW-VXGBXAGGSA-N |
| XLogP | 1.72 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |