C21H27N5O4 — CID 177334785
tert-butyl 8-cyano-7-(dimethylaminomethylideneamino)-4-oxospiro[2H-pyrano[3,2-b]pyridine-3,4'-piperidine]-1'-carboxylate (PubChem CID 177334785) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is tert-butyl 8-cyano-7-(dimethylaminomethylideneamino)-4-oxospiro[2H-pyrano[3,2-b]pyridine-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 8-cyano-7-(dimethylaminomethylideneamino)-4-oxospiro[2H-pyrano[3,2-b]pyridine-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 177334785 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl 8-cyano-7-(dimethylaminomethylideneamino)-4-oxospiro[2H-pyrano[3,2-b]pyridine-3,4'-piperidine]-1'-carboxylate |
| SMILES | CN(C)/C=N/c1cnc2c(c1C#N)OCC1(CCN(C(=O)OC(C)(C)C)CC1)C2=O |
| InChI | InChI=1S/C21H27N5O4/c1-20(2,3)30-19(28)26-8-6-21(7-9-26)12-29-17-14(10-22)15(24-13-25(4)5)11-23-16(17)18(21)27/h11,13H,6-9,12H2,1-5H3/b24-13+ |
| InChIKey | CVMBLUGTERDGQT-ZMOGYAJESA-N |
| XLogP | 2.77 |
| TPSA | 108.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|