C21H24N4O5 — CID 177334742
tert-butyl 8-cyano-7-nitro-4-prop-2-ynylspiro[2H-1,4-benzoxazine-3,4'-piperidine]-1'-carboxylate (PubChem CID 177334742) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is tert-butyl 8-cyano-7-nitro-4-prop-2-ynylspiro[2H-1,4-benzoxazine-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 8-cyano-7-nitro-4-prop-2-ynylspiro[2H-1,4-benzoxazine-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 177334742 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | tert-butyl 8-cyano-7-nitro-4-prop-2-ynylspiro[2H-1,4-benzoxazine-3,4'-piperidine]-1'-carboxylate |
| SMILES | C#CCN1c2ccc([N+](=O)[O-])c(C#N)c2OCC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C21H24N4O5/c1-5-10-24-17-7-6-16(25(27)28)15(13-22)18(17)29-14-21(24)8-11-23(12-9-21)19(26)30-20(2,3)4/h1,6-7H,8-12,14H2,2-4H3 |
| InChIKey | QLHGUYWCBVGMGV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 108.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|