C27H26N8O2 — CID 163751772
2-(1-methyl-3-phenylpyrazol-5-yl)-N-[4-(6-morpholin-4-yl-7H-purin-8-yl)phenyl]acetamide (PubChem CID 163751772) has the molecular formula C27H26N8O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 2-(1-methyl-3-phenylpyrazol-5-yl)-N-[4-(6-morpholin-4-yl-7H-purin-8-yl)phenyl]acetamide.
| Compound Name | 2-(1-methyl-3-phenylpyrazol-5-yl)-N-[4-(6-morpholin-4-yl-7H-purin-8-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 163751772 |
| Molecular Formula | C27H26N8O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-(1-methyl-3-phenylpyrazol-5-yl)-N-[4-(6-morpholin-4-yl-7H-purin-8-yl)phenyl]acetamide |
| SMILES | Cn1nc(-c2ccccc2)cc1CC(=O)Nc1ccc(-c2nc3ncnc(N4CCOCC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C27H26N8O2/c1-34-21(15-22(33-34)18-5-3-2-4-6-18)16-23(36)30-20-9-7-19(8-10-20)25-31-24-26(32-25)28-17-29-27(24)35-11-13-37-14-12-35/h2-10,15,17H,11-14,16H2,1H3,(H,30,36)(H,28,29,31,32) |
| InChIKey | IFQJZOXTXSZFIO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |