C9H5N5O4 — CID 163752551
1-(5-nitrofuran-2-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 163752551) has the molecular formula C9H5N5O4 and a molecular weight of 247.17 g/mol. Its IUPAC name is 1-(5-nitrofuran-2-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-(5-nitrofuran-2-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 163752551 |
| Molecular Formula | C9H5N5O4 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 1-(5-nitrofuran-2-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1cnn2-c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C9H5N5O4/c15-9-5-3-12-13(8(5)10-4-11-9)6-1-2-7(18-6)14(16)17/h1-4H,(H,10,11,15) |
| InChIKey | LRFUHRVHVPFBTC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|