C30H41N3O4 — CID 163753435
N-[3-(2-oxopyrrolidin-1-yl)propylamino]-1-(4-phenyl-2-phenylmethoxycarbonylbutyl)cyclopentan-1-amine oxide (PubChem CID 163753435) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propylamino]-1-(4-phenyl-2-phenylmethoxycarbonylbutyl)cyclopentan-1-amine oxide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propylamino]-1-(4-phenyl-2-phenylmethoxycarbonylbutyl)cyclopentan-1-amine oxide |
|---|---|
| PubChem CID | 163753435 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propylamino]-1-(4-phenyl-2-phenylmethoxycarbonylbutyl)cyclopentan-1-amine oxide |
| SMILES | O=C(OCc1ccccc1)C(CCc1ccccc1)CC1([NH+]([O-])NCCCN2CCCC2=O)CCCC1 |
| InChI | InChI=1S/C30H41N3O4/c34-28-15-9-21-32(28)22-10-20-31-33(36)30(18-7-8-19-30)23-27(17-16-25-11-3-1-4-12-25)29(35)37-24-26-13-5-2-6-14-26/h1-6,11-14,27,31,33H,7-10,15-24H2 |
| InChIKey | LRZVEGAHAXZDPT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|