C8H9N3O3S — CID 163755458
7-amino-2-methyl-3H-benzimidazole-5-sulfonic acid (PubChem CID 163755458) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is 7-amino-2-methyl-3H-benzimidazole-5-sulfonic acid.
| Compound Name | 7-amino-2-methyl-3H-benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 163755458 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 7-amino-2-methyl-3H-benzimidazole-5-sulfonic acid |
| SMILES | Cc1nc2c(N)cc(S(=O)(=O)O)cc2[nH]1 |
| InChI | InChI=1S/C8H9N3O3S/c1-4-10-7-3-5(15(12,13)14)2-6(9)8(7)11-4/h2-3H,9H2,1H3,(H,10,11)(H,12,13,14) |
| InChIKey | LTQZWLGHLBZBQR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|