C7H6N2O2 — CID 163761639
(7aR)-1,7a-dihydro-2,1,3-benzoxadiazole-7-carbaldehyde (PubChem CID 163761639) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is (7aR)-1,7a-dihydro-2,1,3-benzoxadiazole-7-carbaldehyde.
| Compound Name | (7aR)-1,7a-dihydro-2,1,3-benzoxadiazole-7-carbaldehyde |
|---|---|
| PubChem CID | 163761639 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (7aR)-1,7a-dihydro-2,1,3-benzoxadiazole-7-carbaldehyde |
| SMILES | O=CC1=CC=CC2=NON[C@H]12 |
| InChI | InChI=1S/C7H6N2O2/c10-4-5-2-1-3-6-7(5)9-11-8-6/h1-4,7,9H/t7-/m1/s1 |
| InChIKey | LYQYUATXRGBQIB-SSDOTTSWSA-N |
| XLogP | -0.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|