C10H10O2S — CID 112712834
2-(hydroxymethyl)-3a,7a-dihydro-1-benzothiophene-7-carbaldehyde (PubChem CID 112712834) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3a,7a-dihydro-1-benzothiophene-7-carbaldehyde.
| Compound Name | 2-(hydroxymethyl)-3a,7a-dihydro-1-benzothiophene-7-carbaldehyde |
|---|---|
| PubChem CID | 112712834 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-(hydroxymethyl)-3a,7a-dihydro-1-benzothiophene-7-carbaldehyde |
| SMILES | O=CC1=CC=CC2C=C(CO)SC12 |
| InChI | InChI=1S/C10H10O2S/c11-5-8-3-1-2-7-4-9(6-12)13-10(7)8/h1-5,7,10,12H,6H2 |
| InChIKey | YJWFSDFMMCVJJO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|