C10H8O2 — CID 100931779
(1R,2R,6S)-tricyclo[4.2.0.02,5]octa-3,7-diene-1,4-dicarbaldehyde (PubChem CID 100931779) has the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. Its IUPAC name is (1R,2R,6S)-tricyclo[4.2.0.02,5]octa-3,7-diene-1,4-dicarbaldehyde.
| Compound Name | (1R,2R,6S)-tricyclo[4.2.0.02,5]octa-3,7-diene-1,4-dicarbaldehyde |
|---|---|
| PubChem CID | 100931779 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (1R,2R,6S)-tricyclo[4.2.0.02,5]octa-3,7-diene-1,4-dicarbaldehyde |
| SMILES | O=CC1=C[C@@H]2C1[C@@H]1C=C[C@]21C=O |
| InChI | InChI=1S/C10H8O2/c11-4-6-3-8-9(6)7-1-2-10(7,8)5-12/h1-5,7-9H/t7-,8+,9?,10+/m0/s1 |
| InChIKey | YJDFRFHRHOIEKF-LBTMZUADSA-N |
| XLogP | 0.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|