C8H10N2S — CID 112712028
3a,7a-dihydro-1,2-benzothiazol-7-ylmethanamine (PubChem CID 112712028) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 3a,7a-dihydro-1,2-benzothiazol-7-ylmethanamine.
| Compound Name | 3a,7a-dihydro-1,2-benzothiazol-7-ylmethanamine |
|---|---|
| PubChem CID | 112712028 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 3a,7a-dihydro-1,2-benzothiazol-7-ylmethanamine |
| SMILES | NCC1=CC=CC2C=NSC12 |
| InChI | InChI=1S/C8H10N2S/c9-4-6-2-1-3-7-5-10-11-8(6)7/h1-3,5,7-8H,4,9H2 |
| InChIKey | VVPWZOQJCJIOMA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|