C12H18N2 — CID 112712523
2-(1,2-dimethyl-3a,7a-dihydroindol-7-yl)ethanamine (PubChem CID 112712523) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-(1,2-dimethyl-3a,7a-dihydroindol-7-yl)ethanamine.
| Compound Name | 2-(1,2-dimethyl-3a,7a-dihydroindol-7-yl)ethanamine |
|---|---|
| PubChem CID | 112712523 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-(1,2-dimethyl-3a,7a-dihydroindol-7-yl)ethanamine |
| SMILES | CC1=CC2C=CC=C(CCN)C2N1C |
| InChI | InChI=1S/C12H18N2/c1-9-8-11-5-3-4-10(6-7-13)12(11)14(9)2/h3-5,8,11-12H,6-7,13H2,1-2H3 |
| InChIKey | VBYRZHVCDJVTPD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |