C7H13N3O — CID 83856689
5-(2-aminoethyl)-1,2-dimethylpyrazol-3-one (PubChem CID 83856689) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1,2-dimethylpyrazol-3-one.
| Compound Name | 5-(2-aminoethyl)-1,2-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 83856689 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 5-(2-aminoethyl)-1,2-dimethylpyrazol-3-one |
| SMILES | Cn1c(CCN)cc(=O)n1C |
| InChI | InChI=1S/C7H13N3O/c1-9-6(3-4-8)5-7(11)10(9)2/h5H,3-4,8H2,1-2H3 |
| InChIKey | BTHGVWJFLYFTKM-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |