C16H22N2 — CID 39347093
2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanamine (PubChem CID 39347093) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanamine.
| Compound Name | 2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 39347093 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanamine |
| SMILES | Cc1ccc(-n2c(C)cc(CCN)c2C)cc1C |
| InChI | InChI=1S/C16H22N2/c1-11-5-6-16(9-12(11)2)18-13(3)10-15(7-8-17)14(18)4/h5-6,9-10H,7-8,17H2,1-4H3 |
| InChIKey | HBUCXLMZSBGWEK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|