C24H27ClN4O3 — CID 163767009
5-[2-(5-tert-butyl-6-chloro-2H-indazol-3-yl)ethyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide (PubChem CID 163767009) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is 5-[2-(5-tert-butyl-6-chloro-2H-indazol-3-yl)ethyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide.
| Compound Name | 5-[2-(5-tert-butyl-6-chloro-2H-indazol-3-yl)ethyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 163767009 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 5-[2-(5-tert-butyl-6-chloro-2H-indazol-3-yl)ethyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide |
| SMILES | C=CC(=O)N1CC(NC(=O)c2ccc(CCc3[nH]nc4cc(Cl)c(C(C)(C)C)cc34)o2)C1 |
| InChI | InChI=1S/C24H27ClN4O3/c1-5-22(30)29-12-14(13-29)26-23(31)21-9-7-15(32-21)6-8-19-16-10-17(24(2,3)4)18(25)11-20(16)28-27-19/h5,7,9-11,14H,1,6,8,12-13H2,2-4H3,(H,26,31)(H,27,28) |
| InChIKey | MDEJBIXDHQGKEI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|