C18H23N5O3 — CID 154873672
N-(5,5-dimethyl-1-prop-2-enoylpiperidin-3-yl)-5-(triazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 154873672) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(5,5-dimethyl-1-prop-2-enoylpiperidin-3-yl)-5-(triazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-(5,5-dimethyl-1-prop-2-enoylpiperidin-3-yl)-5-(triazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 154873672 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(5,5-dimethyl-1-prop-2-enoylpiperidin-3-yl)-5-(triazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | C=CC(=O)N1CC(NC(=O)c2ccc(Cn3ccnn3)o2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H23N5O3/c1-4-16(24)22-10-13(9-18(2,3)12-22)20-17(25)15-6-5-14(26-15)11-23-8-7-19-21-23/h4-8,13H,1,9-12H2,2-3H3,(H,20,25) |
| InChIKey | MFNUARHRFYAJPA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|