C23H28ClN3O4 — CID 165387765
5-[(5-tert-butyl-4-chloro-2-methoxyanilino)methyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide (PubChem CID 165387765) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is 5-[(5-tert-butyl-4-chloro-2-methoxyanilino)methyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide.
| Compound Name | 5-[(5-tert-butyl-4-chloro-2-methoxyanilino)methyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 165387765 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 5-[(5-tert-butyl-4-chloro-2-methoxyanilino)methyl]-N-(1-prop-2-enoylazetidin-3-yl)furan-2-carboxamide |
| SMILES | C=CC(=O)N1CC(NC(=O)c2ccc(CNc3cc(C(C)(C)C)c(Cl)cc3OC)o2)C1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-6-21(28)27-12-14(13-27)26-22(29)19-8-7-15(31-19)11-25-18-9-16(23(2,3)4)17(24)10-20(18)30-5/h6-10,14,25H,1,11-13H2,2-5H3,(H,26,29) |
| InChIKey | ZOEYKFQINXTXCJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|