C21H25N7 — CID 163768769
1-hex-5-ynyl-2-(1-methylimidazol-2-yl)imidazole;1-methyl-2-(3H-pyrrol-2-yl)imidazole (PubChem CID 163768769) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is 1-hex-5-ynyl-2-(1-methylimidazol-2-yl)imidazole;1-methyl-2-(3H-pyrrol-2-yl)imidazole.
| Compound Name | 1-hex-5-ynyl-2-(1-methylimidazol-2-yl)imidazole;1-methyl-2-(3H-pyrrol-2-yl)imidazole |
|---|---|
| PubChem CID | 163768769 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-hex-5-ynyl-2-(1-methylimidazol-2-yl)imidazole;1-methyl-2-(3H-pyrrol-2-yl)imidazole |
| SMILES | C#CCCCCn1ccnc1-c1nccn1C.Cn1ccnc1C1=NC=CC1 |
| InChI | InChI=1S/C13H16N4.C8H9N3/c1-3-4-5-6-9-17-11-8-15-13(17)12-14-7-10-16(12)2;1-11-6-5-10-8(11)7-3-2-4-9-7/h1,7-8,10-11H,4-6,9H2,2H3;2,4-6H,3H2,1H3 |
| InChIKey | MEQASKPCBANCAC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|