C31H46BrN7O2S2 — CID 163872850
S-(6-bromohexyl) ethanethioate;S-[6-[2-(1-methylimidazol-2-yl)imidazol-1-yl]hexyl] ethanethioate;1-methyl-2-(3H-pyrrol-2-yl)imidazole (PubChem CID 163872850) has the molecular formula C31H46BrN7O2S2 and a molecular weight of 692.79 g/mol. Its IUPAC name is S-(6-bromohexyl) ethanethioate;S-[6-[2-(1-methylimidazol-2-yl)imidazol-1-yl]hexyl] ethanethioate;1-methyl-2-(3H-pyrrol-2-yl)imidazole.
| Compound Name | S-(6-bromohexyl) ethanethioate;S-[6-[2-(1-methylimidazol-2-yl)imidazol-1-yl]hexyl] ethanethioate;1-methyl-2-(3H-pyrrol-2-yl)imidazole |
|---|---|
| PubChem CID | 163872850 |
| Molecular Formula | C31H46BrN7O2S2 |
| Molecular Weight | 692.79 g/mol |
| Exact Mass | 691.23 |
| IUPAC Name | S-(6-bromohexyl) ethanethioate;S-[6-[2-(1-methylimidazol-2-yl)imidazol-1-yl]hexyl] ethanethioate;1-methyl-2-(3H-pyrrol-2-yl)imidazole |
| SMILES | CC(=O)SCCCCCCBr.CC(=O)SCCCCCCn1ccnc1-c1nccn1C.Cn1ccnc1C1=NC=CC1 |
| InChI | InChI=1S/C15H22N4OS.C8H15BrOS.C8H9N3/c1-13(20)21-12-6-4-3-5-9-19-11-8-17-15(19)14-16-7-10-18(14)2;1-8(10)11-7-5-3-2-4-6-9;1-11-6-5-10-8(11)7-3-2-4-9-7/h7-8,10-11H,3-6,9,12H2,1-2H3;2-7H2,1H3;2,4-6H,3H2,1H3 |
| InChIKey | PMIIOYCYDXRCEH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|