C16H15N5O2 — CID 163770056
3-(3-cyanophenyl)-N-(3-diazenylcyclobutyl)-N-methyl-1,2-oxazole-5-carboxamide (PubChem CID 163770056) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-N-(3-diazenylcyclobutyl)-N-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-cyanophenyl)-N-(3-diazenylcyclobutyl)-N-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 163770056 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(3-cyanophenyl)-N-(3-diazenylcyclobutyl)-N-methyl-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=N/C1CC(N(C)C(=O)c2cc(-c3cccc(C#N)c3)no2)C1 |
| InChI | InChI=1S/C16H15N5O2/c1-21(13-6-12(7-13)19-18)16(22)15-8-14(20-23-15)11-4-2-3-10(5-11)9-17/h2-5,8,12-13,18H,6-7H2,1H3/b19-18+ |
| InChIKey | MFQFWYSKSZNHTB-VHEBQXMUSA-N |
| XLogP | 2.85 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|