C10H5BrClNO2 — CID 82371429
3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride (PubChem CID 82371429) has the molecular formula C10H5BrClNO2 and a molecular weight of 286.51 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride.
| Compound Name | 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 82371429 |
| Molecular Formula | C10H5BrClNO2 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 284.92 |
| IUPAC Name | 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(-c2cccc(Br)c2)no1 |
| InChI | InChI=1S/C10H5BrClNO2/c11-7-3-1-2-6(4-7)8-5-9(10(12)14)15-13-8/h1-5H |
| InChIKey | BDOHFDRZQIARJQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|