3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride

C10H5BrClNO2 — CID 82371429

IUPAC3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride
SMILESO=C(Cl)c1cc(-c2cccc(Br)c2)no1
InChIInChI=1S/C10H5BrClNO2/c11-7-3-1-2-6(4-7)8-5-9(10(12)14)15-13-8/h1-5H
InChIKeyBDOHFDRZQIARJQ-UHFFFAOYSA-N
MW286.51 g/mol
LogP3.48
Rot. Bonds2

About 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride

3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride (PubChem CID 82371429) has the molecular formula C10H5BrClNO2 and a molecular weight of 286.51 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride.

Molecular Properties

Compound Name3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride
PubChem CID82371429
Molecular FormulaC10H5BrClNO2
Molecular Weight286.51 g/mol
Exact Mass284.92
IUPAC Name3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride
SMILESO=C(Cl)c1cc(-c2cccc(Br)c2)no1
InChIInChI=1S/C10H5BrClNO2/c11-7-3-1-2-6(4-7)8-5-9(10(12)14)15-13-8/h1-5H
InChIKeyBDOHFDRZQIARJQ-UHFFFAOYSA-N
XLogP3.48
TPSA43.10 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.51
LogP ≤ 53.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride?
The IUPAC name of 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride (CID 82371429) is 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride.
What is the SMILES notation for 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride?
The canonical SMILES for 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride is O=C(Cl)c1cc(-c2cccc(Br)c2)no1.
What is the InChIKey of 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride?
The InChIKey is BDOHFDRZQIARJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrClNO2/c11-7-3-1-2-6(4-7)8-5-9(10(12)14)15-13-8/h1-5H.
What are the key properties of 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride?
3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride has a molecular weight of 286.51 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-1,2-oxazole-5-carbonyl chloride is sourced from PubChem (CID 82371429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).