C9H5ClN2O2 — CID 82371405
3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride (PubChem CID 82371405) has the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. Its IUPAC name is 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride.
| Compound Name | 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 82371405 |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.60 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(-c2ccccn2)no1 |
| InChI | InChI=1S/C9H5ClN2O2/c10-9(13)8-5-7(12-14-8)6-3-1-2-4-11-6/h1-5H |
| InChIKey | TXDGXYCUWJQUJT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|