3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride

C9H5ClN2O2 — CID 82371405

IUPAC3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride
SMILESO=C(Cl)c1cc(-c2ccccn2)no1
InChIInChI=1S/C9H5ClN2O2/c10-9(13)8-5-7(12-14-8)6-3-1-2-4-11-6/h1-5H
InChIKeyTXDGXYCUWJQUJT-UHFFFAOYSA-N
MW208.60 g/mol
LogP2.12
Rot. Bonds2

About 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride

3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride (PubChem CID 82371405) has the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. Its IUPAC name is 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride.

Molecular Properties

Compound Name3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride
PubChem CID82371405
Molecular FormulaC9H5ClN2O2
Molecular Weight208.60 g/mol
Exact Mass208.00
IUPAC Name3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride
SMILESO=C(Cl)c1cc(-c2ccccn2)no1
InChIInChI=1S/C9H5ClN2O2/c10-9(13)8-5-7(12-14-8)6-3-1-2-4-11-6/h1-5H
InChIKeyTXDGXYCUWJQUJT-UHFFFAOYSA-N
XLogP2.12
TPSA55.99 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.60
LogP ≤ 52.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride?
The IUPAC name of 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride (CID 82371405) is 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride.
What is the SMILES notation for 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride?
The canonical SMILES for 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride is O=C(Cl)c1cc(-c2ccccn2)no1.
What is the InChIKey of 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride?
The InChIKey is TXDGXYCUWJQUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O2/c10-9(13)8-5-7(12-14-8)6-3-1-2-4-11-6/h1-5H.
What are the key properties of 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride?
3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride has a molecular weight of 208.60 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-yl-1,2-oxazole-5-carbonyl chloride is sourced from PubChem (CID 82371405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).