C14H14ClNO2 — CID 82371280
3-(4-tert-butylphenyl)-1,2-oxazole-5-carbonyl chloride (PubChem CID 82371280) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1,2-oxazole-5-carbonyl chloride.
| Compound Name | 3-(4-tert-butylphenyl)-1,2-oxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 82371280 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1,2-oxazole-5-carbonyl chloride |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(=O)Cl)on2)cc1 |
| InChI | InChI=1S/C14H14ClNO2/c1-14(2,3)10-6-4-9(5-7-10)11-8-12(13(15)17)18-16-11/h4-8H,1-3H3 |
| InChIKey | ZVUBEKWPIQKKRR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|