C44H30N4 — CID 163770225
1-(3,5-diphenylphenyl)-8-phenyl-2,7-dipyridin-4-ylpyrrolo[3,2-g]indole (PubChem CID 163770225) has the molecular formula C44H30N4 and a molecular weight of 614.75 g/mol. Its IUPAC name is 1-(3,5-diphenylphenyl)-8-phenyl-2,7-dipyridin-4-ylpyrrolo[3,2-g]indole.
| Compound Name | 1-(3,5-diphenylphenyl)-8-phenyl-2,7-dipyridin-4-ylpyrrolo[3,2-g]indole |
|---|---|
| PubChem CID | 163770225 |
| Molecular Formula | C44H30N4 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 1-(3,5-diphenylphenyl)-8-phenyl-2,7-dipyridin-4-ylpyrrolo[3,2-g]indole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-n3c(-c4ccncc4)cc4ccc5cc(-c6ccncc6)n(-c6ccccc6)c5c43)c2)cc1 |
| InChI | InChI=1S/C44H30N4/c1-4-10-31(11-5-1)37-26-38(32-12-6-2-7-13-32)28-40(27-37)48-42(34-20-24-46-25-21-34)30-36-17-16-35-29-41(33-18-22-45-23-19-33)47(43(35)44(36)48)39-14-8-3-9-15-39/h1-30H |
| InChIKey | MFTXEMZEPJNRGD-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |