C23H19F2N3O5 — CID 163772260
3-[[4-fluoro-3-(hydroxyamino)phenyl]methylidene]-5-[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one (PubChem CID 163772260) has the molecular formula C23H19F2N3O5 and a molecular weight of 455.42 g/mol. Its IUPAC name is 3-[[4-fluoro-3-(hydroxyamino)phenyl]methylidene]-5-[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one.
| Compound Name | 3-[[4-fluoro-3-(hydroxyamino)phenyl]methylidene]-5-[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one |
|---|---|
| PubChem CID | 163772260 |
| Molecular Formula | C23H19F2N3O5 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-[[4-fluoro-3-(hydroxyamino)phenyl]methylidene]-5-[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one |
| SMILES | C=CC(=O)N1CCC(=Cc2ccc(F)c([N+](=O)[O-])c2)C(=O)C(=Cc2ccc(F)c(NO)c2)C1 |
| InChI | InChI=1S/C23H19F2N3O5/c1-2-22(29)27-8-7-16(9-15-4-6-19(25)21(12-15)28(32)33)23(30)17(13-27)10-14-3-5-18(24)20(11-14)26-31/h2-6,9-12,26,31H,1,7-8,13H2 |
| InChIKey | IGRUIZRIWVFIFF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|